C16H26N5O2S+ — CID 8639828
(3,4-diethoxyphenyl)methyl-[3-(1-methyltetrazol-5-yl)sulfanylpropyl]azanium (PubChem CID 8639828) has the molecular formula C16H26N5O2S+ and a molecular weight of 352.48 g/mol. Its IUPAC name is (3,4-diethoxyphenyl)methyl-[3-(1-methyltetrazol-5-yl)sulfanylpropyl]azanium.
| Compound Name | (3,4-diethoxyphenyl)methyl-[3-(1-methyltetrazol-5-yl)sulfanylpropyl]azanium |
|---|---|
| PubChem CID | 8639828 |
| Molecular Formula | C16H26N5O2S+ |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | (3,4-diethoxyphenyl)methyl-[3-(1-methyltetrazol-5-yl)sulfanylpropyl]azanium |
| SMILES | CCOc1ccc(C[NH2+]CCCSc2nnnn2C)cc1OCC |
| InChI | InChI=1S/C16H25N5O2S/c1-4-22-14-8-7-13(11-15(14)23-5-2)12-17-9-6-10-24-16-18-19-20-21(16)3/h7-8,11,17H,4-6,9-10,12H2,1-3H3/p+1 |
| InChIKey | AUAYLJNAIXWNOU-UHFFFAOYSA-O |
| XLogP | 1.25 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|