C14H20N7OS+ — CID 7248407
(1,3-dimethyl-2-oxobenzimidazol-5-yl)methyl-[2-(1-methyltetrazol-5-yl)sulfanylethyl]azanium (PubChem CID 7248407) has the molecular formula C14H20N7OS+ and a molecular weight of 334.43 g/mol. Its IUPAC name is (1,3-dimethyl-2-oxobenzimidazol-5-yl)methyl-[2-(1-methyltetrazol-5-yl)sulfanylethyl]azanium.
| Compound Name | (1,3-dimethyl-2-oxobenzimidazol-5-yl)methyl-[2-(1-methyltetrazol-5-yl)sulfanylethyl]azanium |
|---|---|
| PubChem CID | 7248407 |
| Molecular Formula | C14H20N7OS+ |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (1,3-dimethyl-2-oxobenzimidazol-5-yl)methyl-[2-(1-methyltetrazol-5-yl)sulfanylethyl]azanium |
| SMILES | Cn1nnnc1SCC[NH2+]Cc1ccc2c(c1)n(C)c(=O)n2C |
| InChI | InChI=1S/C14H19N7OS/c1-19-11-5-4-10(8-12(11)20(2)14(19)22)9-15-6-7-23-13-16-17-18-21(13)3/h4-5,8,15H,6-7,9H2,1-3H3/p+1 |
| InChIKey | SRHDWNCSCJQQBI-UHFFFAOYSA-O |
| XLogP | -0.74 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|