C15H16Cl2N5OS+ — CID 8622356
[5-(2,5-dichlorophenyl)furan-2-yl]methyl-[2-(1-methyltetrazol-5-yl)sulfanylethyl]azanium (PubChem CID 8622356) has the molecular formula C15H16Cl2N5OS+ and a molecular weight of 385.30 g/mol. Its IUPAC name is [5-(2,5-dichlorophenyl)furan-2-yl]methyl-[2-(1-methyltetrazol-5-yl)sulfanylethyl]azanium.
| Compound Name | [5-(2,5-dichlorophenyl)furan-2-yl]methyl-[2-(1-methyltetrazol-5-yl)sulfanylethyl]azanium |
|---|---|
| PubChem CID | 8622356 |
| Molecular Formula | C15H16Cl2N5OS+ |
| Molecular Weight | 385.30 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | [5-(2,5-dichlorophenyl)furan-2-yl]methyl-[2-(1-methyltetrazol-5-yl)sulfanylethyl]azanium |
| SMILES | Cn1nnnc1SCC[NH2+]Cc1ccc(-c2cc(Cl)ccc2Cl)o1 |
| InChI | InChI=1S/C15H15Cl2N5OS/c1-22-15(19-20-21-22)24-7-6-18-9-11-3-5-14(23-11)12-8-10(16)2-4-13(12)17/h2-5,8,18H,6-7,9H2,1H3/p+1 |
| InChIKey | LDEGBJREHCQOMO-UHFFFAOYSA-O |
| XLogP | 2.63 |
| TPSA | 73.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|