C16H20Cl2NO2+ — CID 8622342
[5-(2,5-dichlorophenyl)furan-2-yl]methyl-(3-ethoxypropyl)azanium (PubChem CID 8622342) has the molecular formula C16H20Cl2NO2+ and a molecular weight of 329.25 g/mol. Its IUPAC name is [5-(2,5-dichlorophenyl)furan-2-yl]methyl-(3-ethoxypropyl)azanium.
| Compound Name | [5-(2,5-dichlorophenyl)furan-2-yl]methyl-(3-ethoxypropyl)azanium |
|---|---|
| PubChem CID | 8622342 |
| Molecular Formula | C16H20Cl2NO2+ |
| Molecular Weight | 329.25 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | [5-(2,5-dichlorophenyl)furan-2-yl]methyl-(3-ethoxypropyl)azanium |
| SMILES | CCOCCC[NH2+]Cc1ccc(-c2cc(Cl)ccc2Cl)o1 |
| InChI | InChI=1S/C16H19Cl2NO2/c1-2-20-9-3-8-19-11-13-5-7-16(21-13)14-10-12(17)4-6-15(14)18/h4-7,10,19H,2-3,8-9,11H2,1H3/p+1 |
| InChIKey | UZCKEUQZSIIPLV-UHFFFAOYSA-O |
| XLogP | 3.74 |
| TPSA | 38.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.25 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|