C17H22Cl2N2O2+2 — CID 7394284
[5-(2,4-dichlorophenyl)furan-2-yl]methyl-(2-morpholin-4-ium-4-ylethyl)azanium (PubChem CID 7394284) has the molecular formula C17H22Cl2N2O2+2 and a molecular weight of 357.28 g/mol. Its IUPAC name is [5-(2,4-dichlorophenyl)furan-2-yl]methyl-(2-morpholin-4-ium-4-ylethyl)azanium.
| Compound Name | [5-(2,4-dichlorophenyl)furan-2-yl]methyl-(2-morpholin-4-ium-4-ylethyl)azanium |
|---|---|
| PubChem CID | 7394284 |
| Molecular Formula | C17H22Cl2N2O2+2 |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | [5-(2,4-dichlorophenyl)furan-2-yl]methyl-(2-morpholin-4-ium-4-ylethyl)azanium |
| SMILES | Clc1ccc(-c2ccc(C[NH2+]CC[NH+]3CCOCC3)o2)c(Cl)c1 |
| InChI | InChI=1S/C17H20Cl2N2O2/c18-13-1-3-15(16(19)11-13)17-4-2-14(23-17)12-20-5-6-21-7-9-22-10-8-21/h1-4,11,20H,5-10,12H2/p+2 |
| InChIKey | NWDNYYJUBPTQJN-UHFFFAOYSA-P |
| XLogP | 1.23 |
| TPSA | 43.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|