C20H30N2O3+2 — CID 7263979
[5-[4-[(1R)-1-hydroxyethyl]phenyl]furan-2-yl]methyl-(3-morpholin-4-ium-4-ylpropyl)azanium (PubChem CID 7263979) has the molecular formula C20H30N2O3+2 and a molecular weight of 346.47 g/mol. Its IUPAC name is [5-[4-[(1R)-1-hydroxyethyl]phenyl]furan-2-yl]methyl-(3-morpholin-4-ium-4-ylpropyl)azanium.
| Compound Name | [5-[4-[(1R)-1-hydroxyethyl]phenyl]furan-2-yl]methyl-(3-morpholin-4-ium-4-ylpropyl)azanium |
|---|---|
| PubChem CID | 7263979 |
| Molecular Formula | C20H30N2O3+2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | [5-[4-[(1R)-1-hydroxyethyl]phenyl]furan-2-yl]methyl-(3-morpholin-4-ium-4-ylpropyl)azanium |
| SMILES | C[C@@H](O)c1ccc(-c2ccc(C[NH2+]CCC[NH+]3CCOCC3)o2)cc1 |
| InChI | InChI=1S/C20H28N2O3/c1-16(23)17-3-5-18(6-4-17)20-8-7-19(25-20)15-21-9-2-10-22-11-13-24-14-12-22/h3-8,16,21,23H,2,9-15H2,1H3/p+2/t16-/m1/s1 |
| InChIKey | DMCDXVZRZITAOS-MRXNPFEDSA-P |
| XLogP | 0.37 |
| TPSA | 63.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|