C17H23ClN2O2+2 — CID 8622846
[5-(3-chlorophenyl)furan-2-yl]methyl-(2-morpholin-4-ium-4-ylethyl)azanium (PubChem CID 8622846) has the molecular formula C17H23ClN2O2+2 and a molecular weight of 322.84 g/mol. Its IUPAC name is [5-(3-chlorophenyl)furan-2-yl]methyl-(2-morpholin-4-ium-4-ylethyl)azanium.
| Compound Name | [5-(3-chlorophenyl)furan-2-yl]methyl-(2-morpholin-4-ium-4-ylethyl)azanium |
|---|---|
| PubChem CID | 8622846 |
| Molecular Formula | C17H23ClN2O2+2 |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | [5-(3-chlorophenyl)furan-2-yl]methyl-(2-morpholin-4-ium-4-ylethyl)azanium |
| SMILES | Clc1cccc(-c2ccc(C[NH2+]CC[NH+]3CCOCC3)o2)c1 |
| InChI | InChI=1S/C17H21ClN2O2/c18-15-3-1-2-14(12-15)17-5-4-16(22-17)13-19-6-7-20-8-10-21-11-9-20/h1-5,12,19H,6-11,13H2/p+2 |
| InChIKey | MHSNHJFJFKXTJQ-UHFFFAOYSA-P |
| XLogP | 0.58 |
| TPSA | 43.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|