C14H17ClNO2+ — CID 7380206
[5-(3-chlorophenyl)furan-2-yl]methyl-[(2R)-2-hydroxypropyl]azanium (PubChem CID 7380206) has the molecular formula C14H17ClNO2+ and a molecular weight of 266.75 g/mol. Its IUPAC name is [5-(3-chlorophenyl)furan-2-yl]methyl-[(2R)-2-hydroxypropyl]azanium.
| Compound Name | [5-(3-chlorophenyl)furan-2-yl]methyl-[(2R)-2-hydroxypropyl]azanium |
|---|---|
| PubChem CID | 7380206 |
| Molecular Formula | C14H17ClNO2+ |
| Molecular Weight | 266.75 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | [5-(3-chlorophenyl)furan-2-yl]methyl-[(2R)-2-hydroxypropyl]azanium |
| SMILES | C[C@@H](O)C[NH2+]Cc1ccc(-c2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C14H16ClNO2/c1-10(17)8-16-9-13-5-6-14(18-13)11-3-2-4-12(15)7-11/h2-7,10,16-17H,8-9H2,1H3/p+1/t10-/m1/s1 |
| InChIKey | HECBAGJYBDITHX-SNVBAGLBSA-O |
| XLogP | 2.04 |
| TPSA | 49.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.75 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |