C18H16Cl2NO+ — CID 8622580
benzyl-[[5-(3,5-dichlorophenyl)furan-2-yl]methyl]azanium (PubChem CID 8622580) has the molecular formula C18H16Cl2NO+ and a molecular weight of 333.24 g/mol. Its IUPAC name is benzyl-[[5-(3,5-dichlorophenyl)furan-2-yl]methyl]azanium.
| Compound Name | benzyl-[[5-(3,5-dichlorophenyl)furan-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 8622580 |
| Molecular Formula | C18H16Cl2NO+ |
| Molecular Weight | 333.24 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | benzyl-[[5-(3,5-dichlorophenyl)furan-2-yl]methyl]azanium |
| SMILES | Clc1cc(Cl)cc(-c2ccc(C[NH2+]Cc3ccccc3)o2)c1 |
| InChI | InChI=1S/C18H15Cl2NO/c19-15-8-14(9-16(20)10-15)18-7-6-17(22-18)12-21-11-13-4-2-1-3-5-13/h1-10,21H,11-12H2/p+1 |
| InChIKey | HYYQEPKFOMDZPH-UHFFFAOYSA-O |
| XLogP | 4.52 |
| TPSA | 29.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.24 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |