C19H19Cl2NO — CID 17332170
N-[[5-(3-chlorophenyl)furan-2-yl]methyl]-2-phenylethanamine;hydrochloride (PubChem CID 17332170) has the molecular formula C19H19Cl2NO and a molecular weight of 348.27 g/mol. Its IUPAC name is N-[[5-(3-chlorophenyl)furan-2-yl]methyl]-2-phenylethanamine;hydrochloride.
| Compound Name | N-[[5-(3-chlorophenyl)furan-2-yl]methyl]-2-phenylethanamine;hydrochloride |
|---|---|
| PubChem CID | 17332170 |
| Molecular Formula | C19H19Cl2NO |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | N-[[5-(3-chlorophenyl)furan-2-yl]methyl]-2-phenylethanamine;hydrochloride |
| SMILES | Cl.Clc1cccc(-c2ccc(CNCCc3ccccc3)o2)c1 |
| InChI | InChI=1S/C19H18ClNO.ClH/c20-17-8-4-7-16(13-17)19-10-9-18(22-19)14-21-12-11-15-5-2-1-3-6-15;/h1-10,13,21H,11-12,14H2;1H |
| InChIKey | SSUHMUOBIPXQEB-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|