C20H20Cl3NO2 — CID 17332138
N-[[5-(3,5-dichlorophenyl)furan-2-yl]methyl]-2-(4-methoxyphenyl)ethanamine;hydrochloride (PubChem CID 17332138) has the molecular formula C20H20Cl3NO2 and a molecular weight of 412.74 g/mol. Its IUPAC name is N-[[5-(3,5-dichlorophenyl)furan-2-yl]methyl]-2-(4-methoxyphenyl)ethanamine;hydrochloride.
| Compound Name | N-[[5-(3,5-dichlorophenyl)furan-2-yl]methyl]-2-(4-methoxyphenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17332138 |
| Molecular Formula | C20H20Cl3NO2 |
| Molecular Weight | 412.74 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | N-[[5-(3,5-dichlorophenyl)furan-2-yl]methyl]-2-(4-methoxyphenyl)ethanamine;hydrochloride |
| SMILES | COc1ccc(CCNCc2ccc(-c3cc(Cl)cc(Cl)c3)o2)cc1.Cl |
| InChI | InChI=1S/C20H19Cl2NO2.ClH/c1-24-18-4-2-14(3-5-18)8-9-23-13-19-6-7-20(25-19)15-10-16(21)12-17(22)11-15;/h2-7,10-12,23H,8-9,13H2,1H3;1H |
| InChIKey | YITHTRRCWJYRBR-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.74 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|