C14H15Cl2NO2 — CID 4723653
1-[[5-(3,5-dichlorophenyl)furan-2-yl]methylamino]propan-2-ol (PubChem CID 4723653) has the molecular formula C14H15Cl2NO2 and a molecular weight of 300.19 g/mol. Its IUPAC name is 1-[[5-(3,5-dichlorophenyl)furan-2-yl]methylamino]propan-2-ol.
| Compound Name | 1-[[5-(3,5-dichlorophenyl)furan-2-yl]methylamino]propan-2-ol |
|---|---|
| PubChem CID | 4723653 |
| Molecular Formula | C14H15Cl2NO2 |
| Molecular Weight | 300.19 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 1-[[5-(3,5-dichlorophenyl)furan-2-yl]methylamino]propan-2-ol |
| SMILES | CC(O)CNCc1ccc(-c2cc(Cl)cc(Cl)c2)o1 |
| InChI | InChI=1S/C14H15Cl2NO2/c1-9(18)7-17-8-13-2-3-14(19-13)10-4-11(15)6-12(16)5-10/h2-6,9,17-18H,7-8H2,1H3 |
| InChIKey | IHWHFSQVJXLOJS-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.19 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |