C10H13Cl2NO — CID 93304494
(2S)-1-[(3,5-dichlorophenyl)methylamino]propan-2-ol (PubChem CID 93304494) has the molecular formula C10H13Cl2NO and a molecular weight of 234.13 g/mol. Its IUPAC name is (2S)-1-[(3,5-dichlorophenyl)methylamino]propan-2-ol.
| Compound Name | (2S)-1-[(3,5-dichlorophenyl)methylamino]propan-2-ol |
|---|---|
| PubChem CID | 93304494 |
| Molecular Formula | C10H13Cl2NO |
| Molecular Weight | 234.13 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | (2S)-1-[(3,5-dichlorophenyl)methylamino]propan-2-ol |
| SMILES | C[C@H](O)CNCc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C10H13Cl2NO/c1-7(14)5-13-6-8-2-9(11)4-10(12)3-8/h2-4,7,13-14H,5-6H2,1H3/t7-/m0/s1 |
| InChIKey | ZHOXFMYEHJZQSK-ZETCQYMHSA-N |
| XLogP | 2.46 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.13 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |