C15H18Cl2FNO — CID 17333094
N-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]-2-methylpropan-1-amine;hydrochloride (PubChem CID 17333094) has the molecular formula C15H18Cl2FNO and a molecular weight of 318.22 g/mol. Its IUPAC name is N-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]-2-methylpropan-1-amine;hydrochloride.
| Compound Name | N-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]-2-methylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17333094 |
| Molecular Formula | C15H18Cl2FNO |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | N-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]-2-methylpropan-1-amine;hydrochloride |
| SMILES | CC(C)CNCc1ccc(-c2ccc(F)c(Cl)c2)o1.Cl |
| InChI | InChI=1S/C15H17ClFNO.ClH/c1-10(2)8-18-9-12-4-6-15(19-12)11-3-5-14(17)13(16)7-11;/h3-7,10,18H,8-9H2,1-2H3;1H |
| InChIKey | ZBJIRUVEAHTWQV-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |