C14H16ClFNO2+ — CID 7425278
[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl-[(2S)-2-hydroxypropyl]azanium (PubChem CID 7425278) has the molecular formula C14H16ClFNO2+ and a molecular weight of 284.74 g/mol. Its IUPAC name is [5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl-[(2S)-2-hydroxypropyl]azanium.
| Compound Name | [5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl-[(2S)-2-hydroxypropyl]azanium |
|---|---|
| PubChem CID | 7425278 |
| Molecular Formula | C14H16ClFNO2+ |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | [5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl-[(2S)-2-hydroxypropyl]azanium |
| SMILES | C[C@H](O)C[NH2+]Cc1ccc(-c2ccc(F)c(Cl)c2)o1 |
| InChI | InChI=1S/C14H15ClFNO2/c1-9(18)7-17-8-11-3-5-14(19-11)10-2-4-13(16)12(15)6-10/h2-6,9,17-18H,7-8H2,1H3/p+1/t9-/m0/s1 |
| InChIKey | JGIOORNBPKXPNW-VIFPVBQESA-O |
| XLogP | 2.18 |
| TPSA | 49.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |