C13H14ClFNO2+ — CID 7425272
[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl-(2-hydroxyethyl)azanium (PubChem CID 7425272) has the molecular formula C13H14ClFNO2+ and a molecular weight of 270.71 g/mol. Its IUPAC name is [5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl-(2-hydroxyethyl)azanium.
| Compound Name | [5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl-(2-hydroxyethyl)azanium |
|---|---|
| PubChem CID | 7425272 |
| Molecular Formula | C13H14ClFNO2+ |
| Molecular Weight | 270.71 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | [5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl-(2-hydroxyethyl)azanium |
| SMILES | OCC[NH2+]Cc1ccc(-c2ccc(F)c(Cl)c2)o1 |
| InChI | InChI=1S/C13H13ClFNO2/c14-11-7-9(1-3-12(11)15)13-4-2-10(18-13)8-16-5-6-17/h1-4,7,16-17H,5-6,8H2/p+1 |
| InChIKey | ZFGINNIXHCJNDY-UHFFFAOYSA-O |
| XLogP | 1.79 |
| TPSA | 49.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.71 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|