C17H22ClFN2O2+2 — CID 8637736
[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl-(2-morpholin-4-ium-4-ylethyl)azanium (PubChem CID 8637736) has the molecular formula C17H22ClFN2O2+2 and a molecular weight of 340.83 g/mol. Its IUPAC name is [5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl-(2-morpholin-4-ium-4-ylethyl)azanium.
| Compound Name | [5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl-(2-morpholin-4-ium-4-ylethyl)azanium |
|---|---|
| PubChem CID | 8637736 |
| Molecular Formula | C17H22ClFN2O2+2 |
| Molecular Weight | 340.83 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | [5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl-(2-morpholin-4-ium-4-ylethyl)azanium |
| SMILES | Fc1ccc(-c2ccc(C[NH2+]CC[NH+]3CCOCC3)o2)cc1Cl |
| InChI | InChI=1S/C17H20ClFN2O2/c18-15-11-13(1-3-16(15)19)17-4-2-14(23-17)12-20-5-6-21-7-9-22-10-8-21/h1-4,11,20H,5-10,12H2/p+2 |
| InChIKey | BSHGZCZFHIHOEM-UHFFFAOYSA-P |
| XLogP | 0.72 |
| TPSA | 43.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.83 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|