C23H28ClFNO+ — CID 8637590
[(1R)-1-(1-adamantyl)ethyl]-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]azanium (PubChem CID 8637590) has the molecular formula C23H28ClFNO+ and a molecular weight of 388.93 g/mol. Its IUPAC name is [(1R)-1-(1-adamantyl)ethyl]-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]azanium.
| Compound Name | [(1R)-1-(1-adamantyl)ethyl]-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 8637590 |
| Molecular Formula | C23H28ClFNO+ |
| Molecular Weight | 388.93 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | [(1R)-1-(1-adamantyl)ethyl]-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methyl]azanium |
| SMILES | C[C@@H]([NH2+]Cc1ccc(-c2ccc(F)c(Cl)c2)o1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H27ClFNO/c1-14(23-10-15-6-16(11-23)8-17(7-15)12-23)26-13-19-3-5-22(27-19)18-2-4-21(25)20(24)9-18/h2-5,9,14-17,26H,6-8,10-13H2,1H3/p+1/t14-,15?,16?,17?,23?/m1/s1 |
| InChIKey | YYTSEPRTIHIGEU-KWJFTMPMSA-O |
| XLogP | 5.41 |
| TPSA | 29.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.93 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |