C23H27Cl2NO — CID 8636426
(1R)-1-(1-adamantyl)-N-[[5-(2,4-dichlorophenyl)furan-2-yl]methyl]ethanamine (PubChem CID 8636426) has the molecular formula C23H27Cl2NO and a molecular weight of 404.38 g/mol. Its IUPAC name is (1R)-1-(1-adamantyl)-N-[[5-(2,4-dichlorophenyl)furan-2-yl]methyl]ethanamine.
| Compound Name | (1R)-1-(1-adamantyl)-N-[[5-(2,4-dichlorophenyl)furan-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 8636426 |
| Molecular Formula | C23H27Cl2NO |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | (1R)-1-(1-adamantyl)-N-[[5-(2,4-dichlorophenyl)furan-2-yl]methyl]ethanamine |
| SMILES | C[C@@H](NCc1ccc(-c2ccc(Cl)cc2Cl)o1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H27Cl2NO/c1-14(23-10-15-6-16(11-23)8-17(7-15)12-23)26-13-19-3-5-22(27-19)20-4-2-18(24)9-21(20)25/h2-5,9,14-17,26H,6-8,10-13H2,1H3/t14-,15?,16?,17?,23?/m1/s1 |
| InChIKey | SVMMIANTOXUSTL-KWJFTMPMSA-N |
| XLogP | 6.95 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |