C19H26Cl3NO — CID 17332919
N-[[5-(2,4-dichlorophenyl)furan-2-yl]methyl]octan-1-amine;hydrochloride (PubChem CID 17332919) has the molecular formula C19H26Cl3NO and a molecular weight of 390.78 g/mol. Its IUPAC name is N-[[5-(2,4-dichlorophenyl)furan-2-yl]methyl]octan-1-amine;hydrochloride.
| Compound Name | N-[[5-(2,4-dichlorophenyl)furan-2-yl]methyl]octan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17332919 |
| Molecular Formula | C19H26Cl3NO |
| Molecular Weight | 390.78 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | N-[[5-(2,4-dichlorophenyl)furan-2-yl]methyl]octan-1-amine;hydrochloride |
| SMILES | CCCCCCCCNCc1ccc(-c2ccc(Cl)cc2Cl)o1.Cl |
| InChI | InChI=1S/C19H25Cl2NO.ClH/c1-2-3-4-5-6-7-12-22-14-16-9-11-19(23-16)17-10-8-15(20)13-18(17)21;/h8-11,13,22H,2-7,12,14H2,1H3;1H |
| InChIKey | AWVWXGUGJPUMIW-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.78 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|