C18H23ClINO2 — CID 17207913
3-butoxy-N-[[5-(2-chloro-4-iodophenyl)furan-2-yl]methyl]propan-1-amine (PubChem CID 17207913) has the molecular formula C18H23ClINO2 and a molecular weight of 447.74 g/mol. Its IUPAC name is 3-butoxy-N-[[5-(2-chloro-4-iodophenyl)furan-2-yl]methyl]propan-1-amine.
| Compound Name | 3-butoxy-N-[[5-(2-chloro-4-iodophenyl)furan-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 17207913 |
| Molecular Formula | C18H23ClINO2 |
| Molecular Weight | 447.74 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | 3-butoxy-N-[[5-(2-chloro-4-iodophenyl)furan-2-yl]methyl]propan-1-amine |
| SMILES | CCCCOCCCNCc1ccc(-c2ccc(I)cc2Cl)o1 |
| InChI | InChI=1S/C18H23ClINO2/c1-2-3-10-22-11-4-9-21-13-15-6-8-18(23-15)16-7-5-14(20)12-17(16)19/h5-8,12,21H,2-4,9-11,13H2,1H3 |
| InChIKey | COTGKLRQTVQFFA-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.74 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|