C16H22Cl3IN2O2 — CID 17214372
2-[3-[[5-(2-chloro-4-iodophenyl)furan-2-yl]methylamino]propylamino]ethanol;dihydrochloride (PubChem CID 17214372) has the molecular formula C16H22Cl3IN2O2 and a molecular weight of 507.63 g/mol. Its IUPAC name is 2-[3-[[5-(2-chloro-4-iodophenyl)furan-2-yl]methylamino]propylamino]ethanol;dihydrochloride.
| Compound Name | 2-[3-[[5-(2-chloro-4-iodophenyl)furan-2-yl]methylamino]propylamino]ethanol;dihydrochloride |
|---|---|
| PubChem CID | 17214372 |
| Molecular Formula | C16H22Cl3IN2O2 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 505.98 |
| IUPAC Name | 2-[3-[[5-(2-chloro-4-iodophenyl)furan-2-yl]methylamino]propylamino]ethanol;dihydrochloride |
| SMILES | Cl.Cl.OCCNCCCNCc1ccc(-c2ccc(I)cc2Cl)o1 |
| InChI | InChI=1S/C16H20ClIN2O2.2ClH/c17-15-10-12(18)2-4-14(15)16-5-3-13(22-16)11-20-7-1-6-19-8-9-21;;/h2-5,10,19-21H,1,6-9,11H2;2*1H |
| InChIKey | BBDYBLSQMFYSCF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 57.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|