C16H19ClINO — CID 17211019
N-[[5-(2-chloro-4-iodophenyl)furan-2-yl]methyl]-2-methylbutan-2-amine (PubChem CID 17211019) has the molecular formula C16H19ClINO and a molecular weight of 403.69 g/mol. Its IUPAC name is N-[[5-(2-chloro-4-iodophenyl)furan-2-yl]methyl]-2-methylbutan-2-amine.
| Compound Name | N-[[5-(2-chloro-4-iodophenyl)furan-2-yl]methyl]-2-methylbutan-2-amine |
|---|---|
| PubChem CID | 17211019 |
| Molecular Formula | C16H19ClINO |
| Molecular Weight | 403.69 g/mol |
| Exact Mass | 403.02 |
| IUPAC Name | N-[[5-(2-chloro-4-iodophenyl)furan-2-yl]methyl]-2-methylbutan-2-amine |
| SMILES | CCC(C)(C)NCc1ccc(-c2ccc(I)cc2Cl)o1 |
| InChI | InChI=1S/C16H19ClINO/c1-4-16(2,3)19-10-12-6-8-15(20-12)13-7-5-11(18)9-14(13)17/h5-9,19H,4,10H2,1-3H3 |
| InChIKey | JWLIUEUTXYUSQJ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.69 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|