C21H22Cl2INO — CID 17211441
N-[[5-(2-chloro-4-iodophenyl)furan-2-yl]methyl]-4-phenylbutan-2-amine;hydrochloride (PubChem CID 17211441) has the molecular formula C21H22Cl2INO and a molecular weight of 502.22 g/mol. Its IUPAC name is N-[[5-(2-chloro-4-iodophenyl)furan-2-yl]methyl]-4-phenylbutan-2-amine;hydrochloride.
| Compound Name | N-[[5-(2-chloro-4-iodophenyl)furan-2-yl]methyl]-4-phenylbutan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 17211441 |
| Molecular Formula | C21H22Cl2INO |
| Molecular Weight | 502.22 g/mol |
| Exact Mass | 501.01 |
| IUPAC Name | N-[[5-(2-chloro-4-iodophenyl)furan-2-yl]methyl]-4-phenylbutan-2-amine;hydrochloride |
| SMILES | CC(CCc1ccccc1)NCc1ccc(-c2ccc(I)cc2Cl)o1.Cl |
| InChI | InChI=1S/C21H21ClINO.ClH/c1-15(7-8-16-5-3-2-4-6-16)24-14-18-10-12-21(25-18)19-11-9-17(23)13-20(19)22;/h2-6,9-13,15,24H,7-8,14H2,1H3;1H |
| InChIKey | KKNNWFFURPPRSL-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.22 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|