C19H17ClINO2 — CID 17208318
N-[[5-(2-chloro-4-iodophenyl)furan-2-yl]methyl]-1-(2-methoxyphenyl)methanamine (PubChem CID 17208318) has the molecular formula C19H17ClINO2 and a molecular weight of 453.71 g/mol. Its IUPAC name is N-[[5-(2-chloro-4-iodophenyl)furan-2-yl]methyl]-1-(2-methoxyphenyl)methanamine.
| Compound Name | N-[[5-(2-chloro-4-iodophenyl)furan-2-yl]methyl]-1-(2-methoxyphenyl)methanamine |
|---|---|
| PubChem CID | 17208318 |
| Molecular Formula | C19H17ClINO2 |
| Molecular Weight | 453.71 g/mol |
| Exact Mass | 453.00 |
| IUPAC Name | N-[[5-(2-chloro-4-iodophenyl)furan-2-yl]methyl]-1-(2-methoxyphenyl)methanamine |
| SMILES | COc1ccccc1CNCc1ccc(-c2ccc(I)cc2Cl)o1 |
| InChI | InChI=1S/C19H17ClINO2/c1-23-18-5-3-2-4-13(18)11-22-12-15-7-9-19(24-15)16-8-6-14(21)10-17(16)20/h2-10,22H,11-12H2,1H3 |
| InChIKey | YHFJFRJFKVUKEE-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.71 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|