C19H17Cl2NO — CID 4724269
N-[[5-(3-chloro-2-methylphenyl)furan-2-yl]methyl]-1-(2-chlorophenyl)methanamine (PubChem CID 4724269) has the molecular formula C19H17Cl2NO and a molecular weight of 346.26 g/mol. Its IUPAC name is N-[[5-(3-chloro-2-methylphenyl)furan-2-yl]methyl]-1-(2-chlorophenyl)methanamine.
| Compound Name | N-[[5-(3-chloro-2-methylphenyl)furan-2-yl]methyl]-1-(2-chlorophenyl)methanamine |
|---|---|
| PubChem CID | 4724269 |
| Molecular Formula | C19H17Cl2NO |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | N-[[5-(3-chloro-2-methylphenyl)furan-2-yl]methyl]-1-(2-chlorophenyl)methanamine |
| SMILES | Cc1c(Cl)cccc1-c1ccc(CNCc2ccccc2Cl)o1 |
| InChI | InChI=1S/C19H17Cl2NO/c1-13-16(6-4-8-17(13)20)19-10-9-15(23-19)12-22-11-14-5-2-3-7-18(14)21/h2-10,22H,11-12H2,1H3 |
| InChIKey | YOWCGNOTDMHVJO-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |