C17H23Cl2NO — CID 17210608
N-[[5-(3-chloro-2-methylphenyl)furan-2-yl]methyl]-3-methylbutan-1-amine;hydrochloride (PubChem CID 17210608) has the molecular formula C17H23Cl2NO and a molecular weight of 328.28 g/mol. Its IUPAC name is N-[[5-(3-chloro-2-methylphenyl)furan-2-yl]methyl]-3-methylbutan-1-amine;hydrochloride.
| Compound Name | N-[[5-(3-chloro-2-methylphenyl)furan-2-yl]methyl]-3-methylbutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17210608 |
| Molecular Formula | C17H23Cl2NO |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | N-[[5-(3-chloro-2-methylphenyl)furan-2-yl]methyl]-3-methylbutan-1-amine;hydrochloride |
| SMILES | Cc1c(Cl)cccc1-c1ccc(CNCCC(C)C)o1.Cl |
| InChI | InChI=1S/C17H22ClNO.ClH/c1-12(2)9-10-19-11-14-7-8-17(20-14)15-5-4-6-16(18)13(15)3;/h4-8,12,19H,9-11H2,1-3H3;1H |
| InChIKey | GKYPSUIMWJLCQU-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|