C20H19Cl4NO — CID 17209848
N-[[5-(3-chloro-2-methylphenyl)furan-2-yl]methyl]-2-(2,4-dichlorophenyl)ethanamine;hydrochloride (PubChem CID 17209848) has the molecular formula C20H19Cl4NO and a molecular weight of 431.19 g/mol. Its IUPAC name is N-[[5-(3-chloro-2-methylphenyl)furan-2-yl]methyl]-2-(2,4-dichlorophenyl)ethanamine;hydrochloride.
| Compound Name | N-[[5-(3-chloro-2-methylphenyl)furan-2-yl]methyl]-2-(2,4-dichlorophenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17209848 |
| Molecular Formula | C20H19Cl4NO |
| Molecular Weight | 431.19 g/mol |
| Exact Mass | 429.02 |
| IUPAC Name | N-[[5-(3-chloro-2-methylphenyl)furan-2-yl]methyl]-2-(2,4-dichlorophenyl)ethanamine;hydrochloride |
| SMILES | Cc1c(Cl)cccc1-c1ccc(CNCCc2ccc(Cl)cc2Cl)o1.Cl |
| InChI | InChI=1S/C20H18Cl3NO.ClH/c1-13-17(3-2-4-18(13)22)20-8-7-16(25-20)12-24-10-9-14-5-6-15(21)11-19(14)23;/h2-8,11,24H,9-10,12H2,1H3;1H |
| InChIKey | DXXBYVWMTQYTSP-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.19 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|