C15H13Cl4N — CID 17209606
2-(2,4-dichlorophenyl)-N-[(2,4-dichlorophenyl)methyl]ethanamine (PubChem CID 17209606) has the molecular formula C15H13Cl4N and a molecular weight of 349.09 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N-[(2,4-dichlorophenyl)methyl]ethanamine.
| Compound Name | 2-(2,4-dichlorophenyl)-N-[(2,4-dichlorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 17209606 |
| Molecular Formula | C15H13Cl4N |
| Molecular Weight | 349.09 g/mol |
| Exact Mass | 346.98 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N-[(2,4-dichlorophenyl)methyl]ethanamine |
| SMILES | Clc1ccc(CCNCc2ccc(Cl)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H13Cl4N/c16-12-3-1-10(14(18)7-12)5-6-20-9-11-2-4-13(17)8-15(11)19/h1-4,7-8,20H,5-6,9H2 |
| InChIKey | HOMNFZGVFSALBN-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.09 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|