C15H13Cl3FN — CID 114452144
N-[(3-chloro-5-fluorophenyl)methyl]-2-(2,4-dichlorophenyl)ethanamine (PubChem CID 114452144) has the molecular formula C15H13Cl3FN and a molecular weight of 332.63 g/mol. Its IUPAC name is N-[(3-chloro-5-fluorophenyl)methyl]-2-(2,4-dichlorophenyl)ethanamine.
| Compound Name | N-[(3-chloro-5-fluorophenyl)methyl]-2-(2,4-dichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 114452144 |
| Molecular Formula | C15H13Cl3FN |
| Molecular Weight | 332.63 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | N-[(3-chloro-5-fluorophenyl)methyl]-2-(2,4-dichlorophenyl)ethanamine |
| SMILES | Fc1cc(Cl)cc(CNCCc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C15H13Cl3FN/c16-12-2-1-11(15(18)8-12)3-4-20-9-10-5-13(17)7-14(19)6-10/h1-2,5-8,20H,3-4,9H2 |
| InChIKey | VYWRXNSBQBEXQQ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.63 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|