C15H12Cl2F3N — CID 118342869
2-(2,6-dichloro-4-fluorophenyl)-N-[(3,5-difluorophenyl)methyl]ethanamine (PubChem CID 118342869) has the molecular formula C15H12Cl2F3N and a molecular weight of 334.17 g/mol. Its IUPAC name is 2-(2,6-dichloro-4-fluorophenyl)-N-[(3,5-difluorophenyl)methyl]ethanamine.
| Compound Name | 2-(2,6-dichloro-4-fluorophenyl)-N-[(3,5-difluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 118342869 |
| Molecular Formula | C15H12Cl2F3N |
| Molecular Weight | 334.17 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | 2-(2,6-dichloro-4-fluorophenyl)-N-[(3,5-difluorophenyl)methyl]ethanamine |
| SMILES | Fc1cc(F)cc(CNCCc2c(Cl)cc(F)cc2Cl)c1 |
| InChI | InChI=1S/C15H12Cl2F3N/c16-14-6-12(20)7-15(17)13(14)1-2-21-8-9-3-10(18)5-11(19)4-9/h3-7,21H,1-2,8H2 |
| InChIKey | SHEKUTQLGIAEDN-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.17 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|