C15H13F4N — CID 62316403
2-(3,5-difluorophenyl)-N-[(3,4-difluorophenyl)methyl]ethanamine (PubChem CID 62316403) has the molecular formula C15H13F4N and a molecular weight of 283.27 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-N-[(3,4-difluorophenyl)methyl]ethanamine.
| Compound Name | 2-(3,5-difluorophenyl)-N-[(3,4-difluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 62316403 |
| Molecular Formula | C15H13F4N |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 2-(3,5-difluorophenyl)-N-[(3,4-difluorophenyl)methyl]ethanamine |
| SMILES | Fc1cc(F)cc(CCNCc2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C15H13F4N/c16-12-5-10(6-13(17)8-12)3-4-20-9-11-1-2-14(18)15(19)7-11/h1-2,5-8,20H,3-4,9H2 |
| InChIKey | GIAGGNGKPARVFJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|