C15H16F2N2 — CID 115211983
3-[[2-(3,4-difluorophenyl)ethylamino]methyl]aniline (PubChem CID 115211983) has the molecular formula C15H16F2N2 and a molecular weight of 262.30 g/mol. Its IUPAC name is 3-[[2-(3,4-difluorophenyl)ethylamino]methyl]aniline.
| Compound Name | 3-[[2-(3,4-difluorophenyl)ethylamino]methyl]aniline |
|---|---|
| PubChem CID | 115211983 |
| Molecular Formula | C15H16F2N2 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 3-[[2-(3,4-difluorophenyl)ethylamino]methyl]aniline |
| SMILES | Nc1cccc(CNCCc2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C15H16F2N2/c16-14-5-4-11(9-15(14)17)6-7-19-10-12-2-1-3-13(18)8-12/h1-5,8-9,19H,6-7,10,18H2 |
| InChIKey | ODQVVIRGBDMXBL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|