C16H16ClF3N2 — CID 166855353
3-[[2-[3-chloro-4-(trifluoromethyl)phenyl]ethylamino]methyl]aniline (PubChem CID 166855353) has the molecular formula C16H16ClF3N2 and a molecular weight of 328.77 g/mol. Its IUPAC name is 3-[[2-[3-chloro-4-(trifluoromethyl)phenyl]ethylamino]methyl]aniline.
| Compound Name | 3-[[2-[3-chloro-4-(trifluoromethyl)phenyl]ethylamino]methyl]aniline |
|---|---|
| PubChem CID | 166855353 |
| Molecular Formula | C16H16ClF3N2 |
| Molecular Weight | 328.77 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 3-[[2-[3-chloro-4-(trifluoromethyl)phenyl]ethylamino]methyl]aniline |
| SMILES | Nc1cccc(CNCCc2ccc(C(F)(F)F)c(Cl)c2)c1 |
| InChI | InChI=1S/C16H16ClF3N2/c17-15-9-11(4-5-14(15)16(18,19)20)6-7-22-10-12-2-1-3-13(21)8-12/h1-5,8-9,22H,6-7,10,21H2 |
| InChIKey | IAFVIWXPNVHRQP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.77 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|