C18H20ClF3N2 — CID 166855355
3-[1-[2-[3-chloro-4-(trifluoromethyl)phenyl]ethylamino]propyl]aniline (PubChem CID 166855355) has the molecular formula C18H20ClF3N2 and a molecular weight of 356.82 g/mol. Its IUPAC name is 3-[1-[2-[3-chloro-4-(trifluoromethyl)phenyl]ethylamino]propyl]aniline.
| Compound Name | 3-[1-[2-[3-chloro-4-(trifluoromethyl)phenyl]ethylamino]propyl]aniline |
|---|---|
| PubChem CID | 166855355 |
| Molecular Formula | C18H20ClF3N2 |
| Molecular Weight | 356.82 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 3-[1-[2-[3-chloro-4-(trifluoromethyl)phenyl]ethylamino]propyl]aniline |
| SMILES | CCC(NCCc1ccc(C(F)(F)F)c(Cl)c1)c1cccc(N)c1 |
| InChI | InChI=1S/C18H20ClF3N2/c1-2-17(13-4-3-5-14(23)11-13)24-9-8-12-6-7-15(16(19)10-12)18(20,21)22/h3-7,10-11,17,24H,2,8-9,23H2,1H3 |
| InChIKey | YGSQMGLRXKJGBX-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.82 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|