C11H10ClF3O2 — CID 165488514
methyl 3-[3-chloro-4-(trifluoromethyl)phenyl]propanoate (PubChem CID 165488514) has the molecular formula C11H10ClF3O2 and a molecular weight of 266.65 g/mol. Its IUPAC name is methyl 3-[3-chloro-4-(trifluoromethyl)phenyl]propanoate.
| Compound Name | methyl 3-[3-chloro-4-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 165488514 |
| Molecular Formula | C11H10ClF3O2 |
| Molecular Weight | 266.65 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | methyl 3-[3-chloro-4-(trifluoromethyl)phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C11H10ClF3O2/c1-17-10(16)5-3-7-2-4-8(9(12)6-7)11(13,14)15/h2,4,6H,3,5H2,1H3 |
| InChIKey | JQIGCBLAFMDCQM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.65 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |