C18H25F3O3 — CID 143869085
methyl 3-[4-heptoxy-3-(trifluoromethyl)phenyl]propanoate (PubChem CID 143869085) has the molecular formula C18H25F3O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is methyl 3-[4-heptoxy-3-(trifluoromethyl)phenyl]propanoate.
| Compound Name | methyl 3-[4-heptoxy-3-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 143869085 |
| Molecular Formula | C18H25F3O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | methyl 3-[4-heptoxy-3-(trifluoromethyl)phenyl]propanoate |
| SMILES | CCCCCCCOc1ccc(CCC(=O)OC)cc1C(F)(F)F |
| InChI | InChI=1S/C18H25F3O3/c1-3-4-5-6-7-12-24-16-10-8-14(9-11-17(22)23-2)13-15(16)18(19,20)21/h8,10,13H,3-7,9,11-12H2,1-2H3 |
| InChIKey | CWNHKBAEJMLNKO-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|