C18H28F3NO — CID 154553827
(2S)-4-[4-heptoxy-3-(trifluoromethyl)phenyl]butan-2-amine (PubChem CID 154553827) has the molecular formula C18H28F3NO and a molecular weight of 331.42 g/mol. Its IUPAC name is (2S)-4-[4-heptoxy-3-(trifluoromethyl)phenyl]butan-2-amine.
| Compound Name | (2S)-4-[4-heptoxy-3-(trifluoromethyl)phenyl]butan-2-amine |
|---|---|
| PubChem CID | 154553827 |
| Molecular Formula | C18H28F3NO |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | (2S)-4-[4-heptoxy-3-(trifluoromethyl)phenyl]butan-2-amine |
| SMILES | CCCCCCCOc1ccc(CC[C@H](C)N)cc1C(F)(F)F |
| InChI | InChI=1S/C18H28F3NO/c1-3-4-5-6-7-12-23-17-11-10-15(9-8-14(2)22)13-16(17)18(19,20)21/h10-11,13-14H,3-9,12,22H2,1-2H3/t14-/m0/s1 |
| InChIKey | KGZSBJSUJMRKJW-AWEZNQCLSA-N |
| XLogP | 5.33 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|