C17H24F3NO2 — CID 87598389
2-amino-2-[4-octoxy-3-(trifluoromethyl)phenyl]acetaldehyde (PubChem CID 87598389) has the molecular formula C17H24F3NO2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 2-amino-2-[4-octoxy-3-(trifluoromethyl)phenyl]acetaldehyde.
| Compound Name | 2-amino-2-[4-octoxy-3-(trifluoromethyl)phenyl]acetaldehyde |
|---|---|
| PubChem CID | 87598389 |
| Molecular Formula | C17H24F3NO2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 2-amino-2-[4-octoxy-3-(trifluoromethyl)phenyl]acetaldehyde |
| SMILES | CCCCCCCCOc1ccc(C(N)C=O)cc1C(F)(F)F |
| InChI | InChI=1S/C17H24F3NO2/c1-2-3-4-5-6-7-10-23-16-9-8-13(15(21)12-22)11-14(16)17(18,19)20/h8-9,11-12,15H,2-7,10,21H2,1H3 |
| InChIKey | DGWJGUYWGIPKAO-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|