C16H24F3NO — CID 43320906
[4-octoxy-2-(trifluoromethyl)phenyl]methanamine (PubChem CID 43320906) has the molecular formula C16H24F3NO and a molecular weight of 303.37 g/mol. Its IUPAC name is [4-octoxy-2-(trifluoromethyl)phenyl]methanamine.
| Compound Name | [4-octoxy-2-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 43320906 |
| Molecular Formula | C16H24F3NO |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | [4-octoxy-2-(trifluoromethyl)phenyl]methanamine |
| SMILES | CCCCCCCCOc1ccc(CN)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H24F3NO/c1-2-3-4-5-6-7-10-21-14-9-8-13(12-20)15(11-14)16(17,18)19/h8-9,11H,2-7,10,12,20H2,1H3 |
| InChIKey | RMZZZNQQEWPTFR-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|