C12H16F3NO3 — CID 129320520
[4-(2-methoxyethoxymethoxy)-2-(trifluoromethyl)phenyl]methanamine (PubChem CID 129320520) has the molecular formula C12H16F3NO3 and a molecular weight of 279.26 g/mol. Its IUPAC name is [4-(2-methoxyethoxymethoxy)-2-(trifluoromethyl)phenyl]methanamine.
| Compound Name | [4-(2-methoxyethoxymethoxy)-2-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 129320520 |
| Molecular Formula | C12H16F3NO3 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | [4-(2-methoxyethoxymethoxy)-2-(trifluoromethyl)phenyl]methanamine |
| SMILES | COCCOCOc1ccc(CN)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H16F3NO3/c1-17-4-5-18-8-19-10-3-2-9(7-16)11(6-10)12(13,14)15/h2-3,6H,4-5,7-8,16H2,1H3 |
| InChIKey | HELAWLOAIPDZMK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|