C14H22BrNO4 — CID 107275281
[2-bromo-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]methanamine (PubChem CID 107275281) has the molecular formula C14H22BrNO4 and a molecular weight of 348.24 g/mol. Its IUPAC name is [2-bromo-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]methanamine.
| Compound Name | [2-bromo-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]methanamine |
|---|---|
| PubChem CID | 107275281 |
| Molecular Formula | C14H22BrNO4 |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | [2-bromo-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]methanamine |
| SMILES | COCCOCCOCCOc1ccc(CN)c(Br)c1 |
| InChI | InChI=1S/C14H22BrNO4/c1-17-4-5-18-6-7-19-8-9-20-13-3-2-12(11-16)14(15)10-13/h2-3,10H,4-9,11,16H2,1H3 |
| InChIKey | KKALGHXMDYITPA-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|