C26H44Br2O10 — CID 134128519
1,4-dibromo-2,5-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxymethyl]benzene (PubChem CID 134128519) has the molecular formula C26H44Br2O10 and a molecular weight of 676.44 g/mol. Its IUPAC name is 1,4-dibromo-2,5-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxymethyl]benzene.
| Compound Name | 1,4-dibromo-2,5-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxymethyl]benzene |
|---|---|
| PubChem CID | 134128519 |
| Molecular Formula | C26H44Br2O10 |
| Molecular Weight | 676.44 g/mol |
| Exact Mass | 674.13 |
| IUPAC Name | 1,4-dibromo-2,5-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxymethyl]benzene |
| SMILES | COCCOCCOCCOCCOCc1cc(Br)c(COCCOCCOCCOCCOC)cc1Br |
| InChI | InChI=1S/C26H44Br2O10/c1-29-3-5-31-7-9-33-11-13-35-15-17-37-21-23-19-26(28)24(20-25(23)27)22-38-18-16-36-14-12-34-10-8-32-6-4-30-2/h19-20H,3-18,21-22H2,1-2H3 |
| InChIKey | CSPMEJCMZUZIDO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|