C18H28F2O6 — CID 58214144
2,4-difluoro-1-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxymethyl]benzene (PubChem CID 58214144) has the molecular formula C18H28F2O6 and a molecular weight of 378.41 g/mol. Its IUPAC name is 2,4-difluoro-1-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxymethyl]benzene.
| Compound Name | 2,4-difluoro-1-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxymethyl]benzene |
|---|---|
| PubChem CID | 58214144 |
| Molecular Formula | C18H28F2O6 |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 2,4-difluoro-1-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxymethyl]benzene |
| SMILES | COCCOCCOCCOCCOCCOCc1ccc(F)cc1F |
| InChI | InChI=1S/C18H28F2O6/c1-21-4-5-22-6-7-23-8-9-24-10-11-25-12-13-26-15-16-2-3-17(19)14-18(16)20/h2-3,14H,4-13,15H2,1H3 |
| InChIKey | QLPNEHQPJBIWRX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|