C11H12F2O3 — CID 43798986
1-(2,4-difluorophenyl)-2-(2-methoxyethoxy)ethanone (PubChem CID 43798986) has the molecular formula C11H12F2O3 and a molecular weight of 230.21 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-2-(2-methoxyethoxy)ethanone.
| Compound Name | 1-(2,4-difluorophenyl)-2-(2-methoxyethoxy)ethanone |
|---|---|
| PubChem CID | 43798986 |
| Molecular Formula | C11H12F2O3 |
| Molecular Weight | 230.21 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 1-(2,4-difluorophenyl)-2-(2-methoxyethoxy)ethanone |
| SMILES | COCCOCC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C11H12F2O3/c1-15-4-5-16-7-11(14)9-3-2-8(12)6-10(9)13/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | UAOBAPQVGJZLKH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.21 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|