C8H5BrF2O — CID 2774185
2-bromo-1-(2,4-difluorophenyl)ethanone (PubChem CID 2774185) has the molecular formula C8H5BrF2O and a molecular weight of 235.03 g/mol. Its IUPAC name is 2-bromo-1-(2,4-difluorophenyl)ethanone.
| Compound Name | 2-bromo-1-(2,4-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 2774185 |
| Molecular Formula | C8H5BrF2O |
| Molecular Weight | 235.03 g/mol |
| Exact Mass | 233.95 |
| IUPAC Name | 2-bromo-1-(2,4-difluorophenyl)ethanone |
| SMILES | O=C(CBr)c1ccc(F)cc1F |
| InChI | InChI=1S/C8H5BrF2O/c9-4-8(12)6-2-1-5(10)3-7(6)11/h1-3H,4H2 |
| InChIKey | CSGDTHXBRAAOHV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.03 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|