C8H6BrF2NO — CID 171017638
1-(2-amino-3,5-difluorophenyl)-2-bromoethanone (PubChem CID 171017638) has the molecular formula C8H6BrF2NO and a molecular weight of 250.04 g/mol. Its IUPAC name is 1-(2-amino-3,5-difluorophenyl)-2-bromoethanone.
| Compound Name | 1-(2-amino-3,5-difluorophenyl)-2-bromoethanone |
|---|---|
| PubChem CID | 171017638 |
| Molecular Formula | C8H6BrF2NO |
| Molecular Weight | 250.04 g/mol |
| Exact Mass | 248.96 |
| IUPAC Name | 1-(2-amino-3,5-difluorophenyl)-2-bromoethanone |
| SMILES | Nc1c(F)cc(F)cc1C(=O)CBr |
| InChI | InChI=1S/C8H6BrF2NO/c9-3-7(13)5-1-4(10)2-6(11)8(5)12/h1-2H,3,12H2 |
| InChIKey | DTDGPLNUXKLREC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.04 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|