C8H4BrClF2O — CID 131094732
2-bromo-1-(2-chloro-4,6-difluorophenyl)ethanone (PubChem CID 131094732) has the molecular formula C8H4BrClF2O and a molecular weight of 269.47 g/mol. Its IUPAC name is 2-bromo-1-(2-chloro-4,6-difluorophenyl)ethanone.
| Compound Name | 2-bromo-1-(2-chloro-4,6-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 131094732 |
| Molecular Formula | C8H4BrClF2O |
| Molecular Weight | 269.47 g/mol |
| Exact Mass | 267.91 |
| IUPAC Name | 2-bromo-1-(2-chloro-4,6-difluorophenyl)ethanone |
| SMILES | O=C(CBr)c1c(F)cc(F)cc1Cl |
| InChI | InChI=1S/C8H4BrClF2O/c9-3-7(13)8-5(10)1-4(11)2-6(8)12/h1-2H,3H2 |
| InChIKey | MJXXQHPBPCHSND-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|