C11H15FN2O3 — CID 76994379
5-fluoro-N'-hydroxy-2-(2-methoxyethoxymethyl)benzenecarboximidamide (PubChem CID 76994379) has the molecular formula C11H15FN2O3 and a molecular weight of 242.25 g/mol. Its IUPAC name is 5-fluoro-N'-hydroxy-2-(2-methoxyethoxymethyl)benzenecarboximidamide.
| Compound Name | 5-fluoro-N'-hydroxy-2-(2-methoxyethoxymethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 76994379 |
| Molecular Formula | C11H15FN2O3 |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 5-fluoro-N'-hydroxy-2-(2-methoxyethoxymethyl)benzenecarboximidamide |
| SMILES | COCCOCc1ccc(F)cc1C(N)=NO |
| InChI | InChI=1S/C11H15FN2O3/c1-16-4-5-17-7-8-2-3-9(12)6-10(8)11(13)14-15/h2-3,6,15H,4-5,7H2,1H3,(H2,13,14) |
| InChIKey | LOJDUUYEGFSWQV-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|