C14H13FN2O2 — CID 76994491
5-fluoro-N'-hydroxy-2-(phenoxymethyl)benzenecarboximidamide (PubChem CID 76994491) has the molecular formula C14H13FN2O2 and a molecular weight of 260.27 g/mol. Its IUPAC name is 5-fluoro-N'-hydroxy-2-(phenoxymethyl)benzenecarboximidamide.
| Compound Name | 5-fluoro-N'-hydroxy-2-(phenoxymethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 76994491 |
| Molecular Formula | C14H13FN2O2 |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 5-fluoro-N'-hydroxy-2-(phenoxymethyl)benzenecarboximidamide |
| SMILES | NC(=NO)c1cc(F)ccc1COc1ccccc1 |
| InChI | InChI=1S/C14H13FN2O2/c15-11-7-6-10(13(8-11)14(16)17-18)9-19-12-4-2-1-3-5-12/h1-8,18H,9H2,(H2,16,17) |
| InChIKey | QZVPMIAGRHRBTF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|